|
|
| | 3-Aminocyclobutanone hydrochloride Basic information |
| Product Name: | 3-Aminocyclobutanone hydrochloride | | Synonyms: | 3-Aminocyclobutanone hydrochloride;3-aminocyclobutanone hydr...;3-AMinocyclobutanone HCl;Cyclobutanone, 3-amino-, hydrochloride;3-aminocyclobutan-1-one hydrochloride;3-Aminocyclobutanone hydrochloride ISO 9001：2015 REACH;3-aminocyclobutan-1-one,dihydrochloride;Cyclobutanone, 3-amino-, hydrochloride (1:1) | | CAS: | 1035374-20-9 | | MF: | C4H7NO.HCl | | MW: | 122 | | EINECS: | 205-248-5 | | Product Categories: | | | Mol File: | 1035374-20-9.mol |  |
| | 3-Aminocyclobutanone hydrochloride Chemical Properties |
| Melting point | 127-130 °C (decomp) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | color | Off-white to brown | | InChI | InChI=1S/C4H7NO.ClH/c5-3-1-4(6)2-3;/h3H,1-2,5H2;1H | | InChIKey | NEQHFBUOBOTJDV-UHFFFAOYSA-N | | SMILES | C1(=O)CC(N)C1.[H]Cl |
| | 3-Aminocyclobutanone hydrochloride Usage And Synthesis |
| Uses | 3-Aminocyclobutanone is used to prepare aminocyclopentenyl- and aminocyclobutylphosphinic acids as γ-aminobutyric acid ρ1 receptor antagonists. It is also used to prepare pyrrolopyrazine derivs. as selective spleen tyrosine kinase inhibitors. |
| | 3-Aminocyclobutanone hydrochloride Preparation Products And Raw materials |
|