| Company Name: |
Heterochem |
| Tel: |
027-88041443 13072715837 |
| Email: |
sales@hetero-chem.com |
|
| | Cyclobutanamine, 3,3-difluoro- (9CI) Basic information | | Uses |
| Product Name: | Cyclobutanamine, 3,3-difluoro- (9CI) | | Synonyms: | Cyclobutanamine, 3,3-difluoro- (9CI);1-Amino-3,3-difluorocyclobutane;CyclobutanaMine, 3,3-difluoro-;3,3-difluorocyclobutanaMine dihydrochloride;OBUTANAMINE;3,3-DIFLUROCYCLOBUTANAMINE;3,3-Difluorocyclobutanamine;3,3-difluorocyclobutan-1-aMine | | CAS: | 791061-00-2 | | MF: | C4H7F2N | | MW: | 107.1 | | EINECS: | | | Product Categories: | VARIOUSAMINE | | Mol File: | 791061-00-2.mol |  |
| | Cyclobutanamine, 3,3-difluoro- (9CI) Chemical Properties |
| Boiling point | 83℃ | | density | 1.17 | | Fp | -11℃ | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | pka | 8.75±0.40(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C4H7F2N/c5-4(6)1-3(7)2-4/h3H,1-2,7H2 | | InChIKey | RKATWUBDSJHPEV-UHFFFAOYSA-N | | SMILES | C1(N)CC(F)(F)C1 |
| | Cyclobutanamine, 3,3-difluoro- (9CI) Usage And Synthesis |
| Uses | 3,3-Difluorocyclobutylamine is an amine derivative used as a pharmaceutical intermediate. |
| | Cyclobutanamine, 3,3-difluoro- (9CI) Preparation Products And Raw materials |
|