|
|
| | tert-Butyl 4-chloro-5-methoxypyridin-3-ylcarbamate Basic information |
| | tert-Butyl 4-chloro-5-methoxypyridin-3-ylcarbamate Chemical Properties |
| form | solid | | InChI | 1S/C11H15ClN2O3/c1-11(2,3)17-10(15)14-7-5-13-6-8(16-4)9(7)12/h5-6H,1-4H3,(H,14,15) | | InChIKey | CMPICGRRRJGMTH-UHFFFAOYSA-N | | SMILES | COc1cncc(NC(=O)OC(C)(C)C)c1Cl |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | tert-Butyl 4-chloro-5-methoxypyridin-3-ylcarbamate Usage And Synthesis |
| | tert-Butyl 4-chloro-5-methoxypyridin-3-ylcarbamate Preparation Products And Raw materials |
|