| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 2-Undecenoic acid Basic information |
| Product Name: | 2-Undecenoic acid | | Synonyms: | RARECHEM AL BK 0167;(2E)-2-Undecenoic acid;TRANS-2-UNDECENOIC ACID: TECH., 80%;(E)-2-Undecenoic acid;trans-2-Undecylenic acid;trans-undec-2-enoic acid;2-Undecenoic acid, (2E)-;Inhibitor,dimers,carboxylic,trans 2 Undecenoic acid,trans2Undecenoic acid,α,β-unsaturated,acid,inhibit | | CAS: | 15790-94-0 | | MF: | C11H20O2 | | MW: | 184.28 | | EINECS: | | | Product Categories: | | | Mol File: | 15790-94-0.mol |  |
| | 2-Undecenoic acid Chemical Properties |
| Melting point | 8.5°C (estimate) | | Boiling point | 138-140°C 2mm | | density | 0.9269 (rough estimate) | | refractive index | 1.4625 | | Fp | 138-140°C/2mm | | storage temp. | Store at -20°C | | solubility | DMSO: 50 mg/mL (271.33 mM) | | form | Liquid | | pka | 4.80±0.10(Predicted) | | color | Colorless to light yellow | | BRN | 1722519 | | InChI | InChI=1S/C11H20O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h9-10H,2-8H2,1H3,(H,12,13)/b10-9+ | | InChIKey | IGBBVTAVILYDIO-MDZDMXLPSA-N | | SMILES | C(O)(=O)/C=C/CCCCCCCC |
| Provider | Language |
|
ALFA
| English |
| | 2-Undecenoic acid Usage And Synthesis |
| Definition | ChEBI: A 2-undecenoic acid in which the olefinic double bond has E configuration. | | Application | 2-Undecenoic acid is an α,β-unsaturated carboxylic acid that can be used in the synthesis of fragrances, lubricants, daily chemicals, pharmaceuticals, and materials. | | Synthesis | 2-Undecenoic acid is an organic intermediate that has been reported in the literature to be prepared in one step by nonanal and diethyl methyl phosphonoacetate or by oxidation of undecanoic acid. |
| | 2-Undecenoic acid Preparation Products And Raw materials |
|