- 1-Adamantyl acrylate
-
-
2025-06-04
- CAS:121601-93-2
- Min. Order: 10g
- Purity: 98%+
- Supply Ability: 1000kg per Month
- 1-Adamantylacrylate
-
- $1.00
-
2019-07-06
- CAS:121601-93-2
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 100KG
|
| | 1-Adamantylacrylate Basic information |
| Product Name: | 1-Adamantylacrylate | | Synonyms: | Acrylic acid 1-adamantyl ester;1-Adamantylacrylate;2-Propenoic acid tricyclo[3.3.1.13,7]dec-1-yl ester;AdaMantan-1-yl acrylate;Adamantan-1-yl Acrylate (stabilized with BHT);1-Acryloyloxyadamantane;Acrylic Acid Adamantan-1-yl Ester;(3s,5s,7s)-Adamantan-1-yl acrylate | | CAS: | 121601-93-2 | | MF: | C13H18O2 | | MW: | 206.28 | | EINECS: | | | Product Categories: | | | Mol File: | 121601-93-2.mol |  |
| | 1-Adamantylacrylate Chemical Properties |
| Melting point | 39 °C | | Boiling point | 272.1±9.0 °C(Predicted) | | density | 1.09 | | storage temp. | 2-8°C | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C13H18O2/c1-2-12(14)15-13-6-9-3-10(7-13)5-11(4-9)8-13/h2,9-11H,1,3-8H2 | | InChIKey | PHPRWKJDGHSJMI-UHFFFAOYSA-N | | SMILES | C(OC12CC3CC(CC(C3)C1)C2)(=O)C=C |
| WGK Germany | WGK 3 | | HS Code | 2902190000 | | Storage Class | 11 - Combustible Solids |
| | 1-Adamantylacrylate Usage And Synthesis |
| | 1-Adamantylacrylate Preparation Products And Raw materials |
|