|
|
| | Trans-4-Amino-1-hydroxy-adamantane Basic information |
| Product Name: | Trans-4-Amino-1-hydroxy-adamantane | | Synonyms: | 4-Amino-1-hydroxy-adamantane;(1R,3S,4S,5S,7S)-rel-4-AMinoadaMantan-1-ol;Trans-4-Amino-1-hydroxy-adamantane;Trans-4-Aminoadamantan-1-ol;(3S,5S)-4-aminoadamantan-1-ol;Tricyclo[3.3.1.13,7]decan-1-ol, 4-amino-, stereoisomer;Adamantane Impurity 13;Rel-(1R,3S,4R)-4-aminoadamantan-1-ol | | CAS: | 62058-03-1 | | MF: | C10H17NO | | MW: | 167.25 | | EINECS: | 229-842-9 | | Product Categories: | | | Mol File: | 62058-03-1.mol |  |
| | Trans-4-Amino-1-hydroxy-adamantane Chemical Properties |
| Melting point | 230-235℃ | | Boiling point | 276℃ | | density | 1.205 | | Fp | 120℃ | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 15.14±0.40(Predicted) | | InChI | InChI=1/C10H17NO/c11-9-7-1-6-2-8(9)5-10(12,3-6)4-7/h6-9,12H,1-5,11H2/t6,7-,8,9,10+/s3 | | InChIKey | HMPCLMSUNVOZLH-ZYOIBGLZNA-N | | SMILES | [C@@]12(O)CC3CC(C[C@]([H])(C3N)C1)C2 |&1:0,7,r| |
| | Trans-4-Amino-1-hydroxy-adamantane Usage And Synthesis |
| | Trans-4-Amino-1-hydroxy-adamantane Preparation Products And Raw materials |
|