| Company Name: |
Pharmalego Gold |
| Tel: |
18321033991 |
| Email: |
marketing@pharmalego.com |
[4-(tert-Butyldimethylsilyloxymethyl)cyclohexyl]methanol
manufacturers
|
| | [4-(tert-Butyldimethylsilyloxymethyl)cyclohexyl]methanol
Basic information |
| | [4-(tert-Butyldimethylsilyloxymethyl)cyclohexyl]methanol
Chemical Properties |
| Boiling point | 301.4±15.0 °C(Predicted) | | density | 0.899±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 15.05±0.10(Predicted) | | Appearance | Colorless to light yellow Oil | | InChI | InChI=1S/C14H30O2Si/c1-14(2,3)17(4,5)16-11-13-8-6-12(10-15)7-9-13/h12-13,15H,6-11H2,1-5H3 | | InChIKey | DWUPTNCOHZJANV-UHFFFAOYSA-N | | SMILES | C1(CO)CCC(CO[Si](C(C)(C)C)(C)C)CC1 |
| | [4-(tert-Butyldimethylsilyloxymethyl)cyclohexyl]methanol
Usage And Synthesis |
| Chemical Properties | Colourless Oil | | Uses | Intermediate in the production of Rho kinase inhibitors and neurite outgrowth promoters. |
| | [4-(tert-Butyldimethylsilyloxymethyl)cyclohexyl]methanol
Preparation Products And Raw materials |
|