|
|
| | trans-1,4-Cyclohexanedimethanol Basic information |
| Product Name: | trans-1,4-Cyclohexanedimethanol | | Synonyms: | TRANS-1,4-CYCLOHEXYLENEDIMETHANOL;TRANS-1,4-DI(HYDROXYMETHYL)CYCLOHEXANE;TRANS-1,4-BIS(HYDROXYMETHYL)CYCLOHEXANE;1,4-CYCLOHEXANEDIMETHANOL (TRANS);trans-4-cyclohexanedimethanol;trans-1,4-Cyclohexanedimethanol,98%;TRANS-1,4-CYCLOHEXANEDIMETHA;(trans-4-Hydroxymethylcyclohexyl)methanol | | CAS: | 3236-48-4 | | MF: | C8H16O2 | | MW: | 144.21 | | EINECS: | | | Product Categories: | Chiral Reagents;Intermediates | | Mol File: | 3236-48-4.mol |  |
| | trans-1,4-Cyclohexanedimethanol Chemical Properties |
| Melting point | 61-66 °C | | Boiling point | 283 °C | | density | 1.02 | | refractive index | 1.4390 (estimate) | | Fp | >109℃ | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform, DMSO, Methanol | | pka | 14.75±0.10(Predicted) | | form | Crystalline Powder | | color | White | | InChI | InChI=1S/C8H16O2/c9-5-7-1-2-8(6-10)4-3-7/h7-10H,1-6H2/t7-,8- | | InChIKey | YIMQCDZDWXUDCA-ZKCHVHJHSA-N | | SMILES | [C@@H]1(CO)CC[C@@H](CO)CC1 | | CAS DataBase Reference | 3236-48-4(CAS DataBase Reference) | | EPA Substance Registry System | 1,4-Cyclohexanedimethanol, trans- (3236-48-4) |
| Risk Statements | 36 | | Safety Statements | 39-26 | | TSCA | TSCA listed | | HS Code | 29051990 |
| Provider | Language |
|
ACROS
| English |
| | trans-1,4-Cyclohexanedimethanol Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | Intermediate in the preparation of Apadenoson. |
| | trans-1,4-Cyclohexanedimethanol Preparation Products And Raw materials |
| Raw materials | 1,4-Cyclohexanedimethanol,1,4-diacetate-->1,4-Cyclohexanedimethanol, diacetate, trans- (8CI,9CI)-->trans [4-(tert-Butyldimethylsilanyloxymethyl)-cyclohexyl]-methanol-->[4-(hydroxymethyl)cyclohexyl]methanol-->trans-1,4-Cyclohexanedicarboxybic acid-->Dimethyl 1,4-cyclohexanedicarboxylate-->trans-1,4-Cyclohexanedicarboxylic acid diethyl ester-->1,4-Cyclohexanedimethanol-->4-Methyl-1-cyclohexanemethanol-->Dimethyl trans-1,4-cyclohexanedicarboxylate-->Dimethyl terephthalate | | Preparation Products | Cyclohexanecarboxylic acid, 4-(hydroxymethyl)-, ethyl ester-->Terephthalic acid |
|