| Company Name: |
Suzhouhongxiong Gold |
| Tel: |
18051745768 |
| Email: |
Suzhouhongxiong@163.com |
|
| | Di(N-succinimidyl) adipate Basic information |
| Product Name: | Di(N-succinimidyl) adipate | | Synonyms: | Di(N-succinimidyl) adipate;Bis-N-Hydroxysuccinimidyl adipate;Hexanedioic acid 1,6-bis(2,5-dioxo-1-pyrrolidinyl) ester;RG 00/265;2,5-Pyrrolidinedione, 1,1'-[(1,6-dioxo-1,6-hexanediyl)bis(oxy)]bis-;bis(2,5-dioxopyrrolidin-1-yl) adipate;bis(2,5-dioxopyrrolidin-1-yl) hexanedioate;Adipic acid bis-(N-hydroxysuccinimide) ester | | CAS: | 59156-70-6 | | MF: | C14H16N2O8 | | MW: | 340.29 | | EINECS: | | | Product Categories: | | | Mol File: | 59156-70-6.mol |  |
| | Di(N-succinimidyl) adipate Chemical Properties |
| Melting point | 163-164℃ (ethanol acetonitrile ) | | Boiling point | 495.3±55.0 °C(Predicted) | | density | 1.48±0.1 g/cm3 (20 ºC 760 Torr) | | storage temp. | Storage temp. -20°C | | solubility | Soluble in DMSO, DMF, Acetonitrile | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C14H16N2O8/c17-9-5-6-10(18)15(9)23-13(21)3-1-2-4-14(22)24-16-11(19)7-8-12(16)20/h1-8H2 | | InChIKey | LZZXZDMVRZJZST-UHFFFAOYSA-N | | SMILES | C(ON1C(=O)CCC1=O)(=O)CCCCC(ON1C(=O)CCC1=O)=O |
| | Di(N-succinimidyl) adipate Usage And Synthesis |
| Description | Di(N-succinimidyl)adipate contains two NHS ester groups which can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules. | | Uses | Di(N-succinimidyl)adipate is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. | | IC 50 | Alkyl-Chain | | References | [1] An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 DOI:10.1016/j.ebiom.2018.09.005 |
| | Di(N-succinimidyl) adipate Preparation Products And Raw materials |
|