|
|
| | 4-Bromo-2-methylphenylboronic acid Basic information |
| Product Name: | 4-Bromo-2-methylphenylboronic acid | | Synonyms: | 4-Bromo-2-methylphenylboronic acid;Boronic acid, (4-bromo-2-methylphenyl)- (9CI);4-Bromo-2-methylphenylboronic acid (contains varying amounts of Anhydride);4-Bromo-2-methylphenyboronic acid | | CAS: | 221006-71-9 | | MF: | C7H8BBrO2 | | MW: | 214.85 | | EINECS: | | | Product Categories: | | | Mol File: | 221006-71-9.mol |  |
| | 4-Bromo-2-methylphenylboronic acid Chemical Properties |
| Boiling point | 331.0±52.0 °C(Predicted) | | density | 1.57±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | pka | 8.40±0.58(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H8BBrO2/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4,10-11H,1H3 | | InChIKey | BEQUDVVISBTSHZ-UHFFFAOYSA-N | | SMILES | C1(B(O)O)=CC=C(Br)C=C1C |
| | 4-Bromo-2-methylphenylboronic acid Usage And Synthesis |
| Uses | 4-Bromo-2-methylphenylboronic Acid can be used as TLR inhibitors to treat inflammatory and autoimmune diseases. |
| | 4-Bromo-2-methylphenylboronic acid Preparation Products And Raw materials |
|