|
|
| | 3-Bromo-2-methylphenylboronic acid Basic information |
| Product Name: | 3-Bromo-2-methylphenylboronic acid | | Synonyms: | 3-Bromo-2-methylphenylboronic acid;Boronic acid, B-(3-bromo-2-methylphenyl)-;(3-bromo-2-methylphenyl)boronic acid(contains varying amounts of Anhydride);(3-bromo-2-methyl-phenyl)boronic acid - [B70987] | | CAS: | 1184298-27-8 | | MF: | C7H8BBrO2 | | MW: | 214.85 | | EINECS: | | | Product Categories: | | | Mol File: | 1184298-27-8.mol |  |
| | 3-Bromo-2-methylphenylboronic acid Chemical Properties |
| storage temp. | Store at room temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H8BBrO2/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4,10-11H,1H3 | | InChIKey | OMIGTINRSKSQNS-UHFFFAOYSA-N | | SMILES | B(C1=CC=CC(Br)=C1C)(O)O |
| | 3-Bromo-2-methylphenylboronic acid Usage And Synthesis |
| | 3-Bromo-2-methylphenylboronic acid Preparation Products And Raw materials |
|