|
|
| | 4-Chloro-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine Basic information |
| | 4-Chloro-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine Chemical Properties |
| density | 1.569±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | form | solid | | pka | 11.92±0.40(Predicted) | | Appearance | White to off-white Solid | | InChI | 1S/C8H4ClF3N2/c9-6-4-1-2-13-7(4)14-3-5(6)8(10,11)12/h1-3H,(H,13,14) | | InChIKey | ATLADCFKPSZUNL-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1cnc2[nH]ccc2c1Cl |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | HazardClass | IRRITANT | | HS Code | 2933998090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 4-Chloro-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine Usage And Synthesis |
| | 4-Chloro-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine Preparation Products And Raw materials |
|