| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
BTZO 1 manufacturers
- BTZO-1
-
- $48.00
-
2026-05-11
- CAS:99420-15-2
- Purity: 99.46%
- Supply Ability: 10g
|
| Product Name: | BTZO 1 | | Synonyms: | BTZO 1;2-Pyridin-2-yl-4H-1,3-benzothiazin-4-one;2-(2-Pyridinyl)-4H-1,3-benzothiazin-4-one;BTZO-1
(BTZO 1);2-(Pyridin-2-yl)-4H-benzo[e][1,3]thiazin-4-one;4H-1,3-Benzothiazin-4-one, 2-(2-pyridinyl)-;stress,inhibit,Cardiomyocyte,oxidative,Inhibitor,BTZO-1,Apoptosis,BTZO 1,BTZO1;BTZO-1, 10 mM in DMSO | | CAS: | 99420-15-2 | | MF: | C13H8N2OS | | MW: | 240.28 | | EINECS: | | | Product Categories: | | | Mol File: | 99420-15-2.mol |  |
| | BTZO 1 Chemical Properties |
| Boiling point | 454.9±37.0 °C(Predicted) | | density | 1.35±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | DMSO: ≥7mg/mL | | form | powder | | pka | -0.01±0.19(Predicted) | | color | white to tan | | InChI | 1S/C13H8N2OS/c16-12-9-5-1-2-7-11(9)17-13(15-12)10-6-3-4-8-14-10/h1-8H | | InChIKey | GBAKVEWPYUIGHN-UHFFFAOYSA-N | | SMILES | O=C1N=C(Sc2ccccc12)c3ccccn3 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | BTZO 1 Usage And Synthesis |
| Uses | BTZO 1 is a binder of the macrophage migration inhibitory factor (MIF). | | Biological Activity | BTZO-1 is a suppressor of cardiomyocyte apoptosis presumably by activation of antioxidant response element (ARE)-mediated gene expression. BTZO-1 binds to the macrophage migration inhibitory factor (MIF) th at is required to activate the glutathione S-transferase Ya subunit (GST Ya) gene ARE. | | storage | Store at RT |
| | BTZO 1 Preparation Products And Raw materials |
|