|
|
| | 2-Bromocyclohexane-1,3-dione Basic information |
| | 2-Bromocyclohexane-1,3-dione Chemical Properties |
| Melting point | 159-161° | | Boiling point | 272.6±40.0 °C(Predicted) | | density | 1.678±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | solubility | DMSO, Methanol | | form | Solid | | pka | 3.46±0.25(Predicted) | | color | Pale Beige Colour | | InChI | InChI=1S/C6H7BrO2/c7-6-4(8)2-1-3-5(6)9/h6H,1-3H2 | | InChIKey | UBUJDMSDEQBNTG-UHFFFAOYSA-N | | SMILES | C1(=O)CCCC(=O)C1Br |
| HazardClass | IRRITANT | | HS Code | 2914790090 |
| | 2-Bromocyclohexane-1,3-dione Usage And Synthesis |
| Uses | 2-Bromo-1,3-cyclohexanedione is an starting material in the synthesis of azole derivatives as histamine H3 receptor antagonists. |
| | 2-Bromocyclohexane-1,3-dione Preparation Products And Raw materials |
|