|
|
| | (E)-1-Ethoxyethene-2-ylboronic acid pinacol ester Basic information | | Synthesis |
| Product Name: | (E)-1-Ethoxyethene-2-ylboronic acid pinacol ester | | Synonyms: | (E)-(2-Ethoxyvinyl)boronic acid, pinacol ester 98%;(E)-1-Ethoxyethene-2-ylboronic acid pinacol ester;(E)-3-hydroxy-2,3-dimethylbutan-2-yl hydrogen 2-ethoxyvinylboronate;E-2-Ethoxyethenyl-1-boronic acid pinacol ester;trans-2-Ethoxyethenyl-1-boronic acid pinacol ester≥ 98%;2-[(E)-2-ethoxyethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;(E)-2-(2-Ethoxy-vinyl)-boronic acid pinacol ester;trans-2-Ethoxyvinylboronic acid pinacol ester 97% | | CAS: | 1201905-61-4 | | MF: | C10H19BO3 | | MW: | 198.07 | | EINECS: | | | Product Categories: | | | Mol File: | 1201905-61-4.mol |  |
| | (E)-1-Ethoxyethene-2-ylboronic acid pinacol ester Chemical Properties |
| Boiling point | 50℃/0.3mm | | density | 0.935 g/mL at 25 °C | | refractive index | 1.4460 | | Fp | 86℃ | | storage temp. | 2-8°C | | form | liquid | | color | Clear, colourless | | InChI | InChI=1S/C10H19BO3/c1-6-12-8-7-11-13-9(2,3)10(4,5)14-11/h7-8H,6H2,1-5H3/b8-7+ | | InChIKey | MRAYNLYCQPAZJN-BQYQJAHWSA-N | | SMILES | O1C(C)(C)C(C)(C)OB1/C=C/OCC |
| RIDADR | NA 1993 / PGIII | | WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 10 - Combustible liquids |
| | (E)-1-Ethoxyethene-2-ylboronic acid pinacol ester Usage And Synthesis |
| Synthesis | 
4,4,5,5-Tetramethyl-1,3,2-dioxaborhexacyclopentane (5.69 ml, 39.2 mmol, 1.1 equivalent) and di(cyclopentadienyl)zirconium(IV) chloride hydride (0.55 g, 2.14 mmol, 0.06 eq) were added to a stirred solution of ethoxyacetylene (2.5 g, 35.7 mmol, 1 equivalent) in DCM (60 ml). The reaction mixture was stirred at room temperature for 12 h. After the starting material was consumed, the reaction mixture was filtered through a neutral alumina pad topped with a diatomaceous earth layer and washed with DCM (50 ml). The resulting filtrate was evaporated under vacuum to obtain crude (E)-1-Ethoxyethene-2-ylboronic acid pinacol ester, which was a brown liquid (6.5 g). | | Uses | trans-2-Ethoxyvinylboronic acid pinacol ester is a boronic ester commonly used in Suzuki-Miyaura cross-coupling.
This reaction is a key step to synthesize:
- Azaindole and diazaindoles from chloroamino-N-heterocycles.
- Doryanine and its derivatives from 2-bromobenzoic acid.
|
| | (E)-1-Ethoxyethene-2-ylboronic acid pinacol ester Preparation Products And Raw materials |
|