|
|
| | (E)-2-(3-Methoxy-1-propen-1-yl)-4 4 5 5& Basic information |
| Product Name: | (E)-2-(3-Methoxy-1-propen-1-yl)-4 4 5 5& | | Synonyms: | trans-3-Methoxy-1-propenylboronic acid pinacol ester, 95%;(e)-2-(3-methoxy-1-propen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;trans-3-Methoxy-1-propenylboronic acid pinacol ester 95%;2-(3-Methoxyprop-1-en-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;1,3,2-Dioxaborolane, 2-[(1E)-3-methoxy-1-propen-1-yl]-4,4,5,5-tetramethyl-;2-[(E)-3-methoxyprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;(E)-2-(3-Methoxyprop-1-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;trans-3-Methoxy-1-propenylboronic acid pinacol ester | | CAS: | 165059-42-7 | | MF: | C10H19BO3 | | MW: | 198.07 | | EINECS: | | | Product Categories: | | | Mol File: | 165059-42-7.mol |  |
| | (E)-2-(3-Methoxy-1-propen-1-yl)-4 4 5 5& Chemical Properties |
| Boiling point | 229-230 °C(lit.) | | density | 0.933 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.4430(lit.) | | Fp | 214 °F | | storage temp. | -20°C, stored under nitrogen | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C10H19BO3/c1-9(2)10(3,4)14-11(13-9)7-6-8-12-5/h6-7H,8H2,1-5H3/b7-6+ | | InChIKey | FBAOFKFCKHJXRU-VOTSOKGWSA-N | | SMILES | COC\C=C\B1OC(C)(C)C(C)(C)O1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (E)-2-(3-Methoxy-1-propen-1-yl)-4 4 5 5& Usage And Synthesis |
| | (E)-2-(3-Methoxy-1-propen-1-yl)-4 4 5 5& Preparation Products And Raw materials |
|