|
|
| | 2,6-dibroMo-3,5-difluoropyridine Basic information | | Preparation |
| | 2,6-dibroMo-3,5-difluoropyridine Chemical Properties |
| Boiling point | 206.5±35.0 °C(Predicted) | | density | 2.210±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -8.49±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C5HBr2F2N/c6-4-2(8)1-3(9)5(7)10-4/h1H | | InChIKey | VOFPGLZHLDBACN-UHFFFAOYSA-N | | SMILES | C1(Br)=NC(Br)=C(F)C=C1F |
| | 2,6-dibroMo-3,5-difluoropyridine Usage And Synthesis |
| Preparation | This reaction was repeated in an attempt to discover the source of the hydrogen in the product (21), however, reaction of (11) with (24a) using deuterated acetonitrile as the solvent gave 2,6-dibromo-3,5-difluoropyridine, (41 %). Reagents and conditions; i, 1-Trimethylsilyloxycyclohexene (2.5 equiv.), 3KF, MeCN, RT 16h and 60℃ 8h. |
| | 2,6-dibroMo-3,5-difluoropyridine Preparation Products And Raw materials |
|