| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-Chloro-7-sulfobenzofurazan ammonium salt Basic information |
| Product Name: | 4-Chloro-7-sulfobenzofurazan ammonium salt | | Synonyms: | 7-CHLORO-4-SULFOBENZ-2-OXA-1,3-DIAZOLE AMMONIUM SALT;7-CHLORO-4-BENZOFURANSULFONIC ACID;7-CHLORO-4-BENZOFURANSULFONIC ACID, AMMONIUM SALT;7-CHLORO-4-BENZOFURAZANSULFONIC ACID AMMONIUM SALT;AMMONIUM 7-CHLORO-2,1,3-BENZOXADIAZOLE-4-SULFONATE;AMMONIUM 4-CHLORO-7-SULFOBENZOFURAZAN;SBF-CHLORIDE;SBF-CL | | CAS: | 81377-14-2 | | MF: | C6H6ClN3O4S | | MW: | 251.65 | | EINECS: | | | Product Categories: | marker | | Mol File: | 81377-14-2.mol |  |
| | 4-Chloro-7-sulfobenzofurazan ammonium salt Chemical Properties |
| Melting point | >300 °C(lit.) | | density | 1.615 (estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | room temp | | solubility | water: 50 mg/mL, clear, dark yellow | | form | powder | | color | brown
light yellow | | Water Solubility | water: 50mg/mL, clear, dark yellow | | BRN | 5200152 | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C6H3ClN2O4S.H3N/c7-3-1-2-4(14(10,11)12)6-5(3)8-13-9-6;/h1-2H,(H,10,11,12);1H3 | | InChIKey | QFHXPBLOMHGYOC-UHFFFAOYSA-N | | SMILES | N.OS(=O)(=O)c1ccc(Cl)c2nonc12 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 8-10 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-Chloro-7-sulfobenzofurazan ammonium salt Usage And Synthesis |
| Chemical Properties | White glistening flakes | | Uses | For the specific fluorescent determination of thiols. | | Uses | 4-Chloro-7-sulfobenzofurazan Ammonium Salt is a stain/dye. Dyes and metabolites. |
| | 4-Chloro-7-sulfobenzofurazan ammonium salt Preparation Products And Raw materials |
|