| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
(S)-1-(3-Chlorophenyl)-1,3-propanediol manufacturers
|
| | (S)-1-(3-Chlorophenyl)-1,3-propanediol Basic information | | Uses |
| Product Name: | (S)-1-(3-Chlorophenyl)-1,3-propanediol | | Synonyms: | (S)-1-(3-Chlorophenyl)-1,3-propanediol;1,3-Propanediol, 1-(3-chlorophenyl)-, (1S)-;(S)-1-(3-CHLOROPHENYL)-1,3-PROPANEDIO;(S)-1-(3-Chlorophenyl)propane-1,3-diol - [C91383];(1S)-1-(3-Chlorophenyl)-1,3-propanediol;(S)-1-(3-chlorophenyl)propane-1,3-diol | | CAS: | 625095-57-0 | | MF: | C9H11ClO2 | | MW: | 186.64 | | EINECS: | | | Product Categories: | | | Mol File: | 625095-57-0.mol |  |
| | (S)-1-(3-Chlorophenyl)-1,3-propanediol Chemical Properties |
| Melting point | 142-144 °C | | Boiling point | 345.3±27.0 °C(Predicted) | | density | 1.274±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | pka | 13.68±0.20(Predicted) | | Appearance | Colorless to light yellow Liquid | | Optical Rotation | Consistent with structure | | InChI | InChI=1S/C9H11ClO2/c10-8-3-1-2-7(6-8)9(12)4-5-11/h1-3,6,9,11-12H,4-5H2/t9-/m0/s1 | | InChIKey | VJGRFGFLZJIODS-VIFPVBQESA-N | | SMILES | [C@H](C1=CC=CC(Cl)=C1)(O)CCO |
| | (S)-1-(3-Chlorophenyl)-1,3-propanediol Usage And Synthesis |
| Uses | (S)-1-(3-chlorophenyl)-1,3-propanediol, as a chiral organic compound, is used in pharmaceutical synthesis and experimental research. |
| | (S)-1-(3-Chlorophenyl)-1,3-propanediol Preparation Products And Raw materials |
|