- Diphosphoryl chloride
-
-
2026-08-20
- CAS:13498-14-1
- Min. Order: 25KG
- Purity: 98%min
- Supply Ability: 30tons/month
|
| | Diphosphoryl chloride Basic information |
| | Diphosphoryl chloride Chemical Properties |
| Melting point | <-50°C | | Boiling point | 90 °C12 mm Hg(lit.) | | density | 1.82 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.476 | | Fp | 101°C/10mm | | storage temp. | −20°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Liquid | | color | Colorless to pale yellow | | Specific Gravity | 1.82 | | Water Solubility | Reacts violently with waterMiscible with most organic solvents. | | Sensitive | Air & Moisture Sensitive | | InChI | InChI=1S/Cl4O3P2/c1-8(2,5)7-9(3,4)6 | | InChIKey | CNTIXUGILVWVHR-UHFFFAOYSA-N | | SMILES | P(Cl)(Cl)(OP(Cl)(Cl)=O)=O | | CAS DataBase Reference | 13498-14-1(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 14-34 | | Safety Statements | 26-36/37/39-45-60-30-23-20-8 | | RIDADR | UN 3264 8/PG 2 | | WGK Germany | 3 | | F | 10-21 | | HazardClass | 8 | | PackingGroup | II | | HS Code | 28121049 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | Diphosphoryl chloride Usage And Synthesis |
| Chemical Properties | Diphosphoryl chloride is a colorless liquid that produces smoke upon exposure to air and reacts violently with water. At temperatures as low as -30°C, it can react with water to form dichlorophosphoric acid (HPO2C12). The compound is soluble in a variety of solvents, including phosphorus trichloride, phosphorus oxychloride, thionyl chloride, benzene, other hydrocarbons, ether, and nitrobenzene. | | Uses | Pyrophosphoryl chloride serves as a reductive chlorination reagent used in the synthesis of quetiapine. It acts as a phosphorylating agent involved in nucleoside synthesis. It plays an important role in Vilsmeier formylation and glyoxylation reactions. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: ligand | | References | [1] CHEN H, XU X, LIU L L, et al. Phosphorus oxychloride as an efficient coupling reagent for the synthesis of esters, amides and peptides under mild conditions?[J]. RSC Advances, 2013, 37: 16247-16250. DOI:10.1039/C3RA42887G.
[2] YOUSANG HWANG Philip A C. Efficient Synthesis of Phosphorylated Prodrugs with Bis(POM)-phosphoryl Chloride[J]. Organic Letters, 2004, 6 10: 1555-1556. DOI:10.1021/ol049714v. |
| | Diphosphoryl chloride Preparation Products And Raw materials |
|