|
|
| | 3-(Methylsulfonyl)-5-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)pyridine Basic information |
| Product Name: | 3-(Methylsulfonyl)-5-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)pyridine | | Synonyms: | 3-(Methylsulfonyl)-5-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)pyridine;5-(Methylsulfonyl)pyridine-3-boronic acid pinacol ester, 95%;Pyridine, 3-(methylsulfonyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-;5-(Methylsulfonyl)pyridine-3-boronic acid pinacol ester | | CAS: | 1206641-26-0 | | MF: | C12H18BNO4S | | MW: | 283.15 | | EINECS: | | | Product Categories: | | | Mol File: | 1206641-26-0.mol |  |
| | 3-(Methylsulfonyl)-5-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)pyridine Chemical Properties |
| Boiling point | 462.2±45.0 °C(Predicted) | | density | 1.21±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | 1.67±0.22(Predicted) | | Appearance | Light brown to brown Solid | | InChI | 1S/C12H18BNO4S/c1-11(2)12(3,4)18-13(17-11)9-6-10(8-14-7-9)19(5,15)16/h6-8H,1-5H3 | | InChIKey | BFWBUXKEBXAKDE-UHFFFAOYSA-N | | SMILES | CC(O1)(C)C(C)(C)OB1C2=CN=CC(S(C)(=O)=O)=C2 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | WGK 3 | | HS Code | 2933399990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 3-(Methylsulfonyl)-5-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)pyridine Usage And Synthesis |
| | 3-(Methylsulfonyl)-5-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)pyridine Preparation Products And Raw materials |
|