(R)-N-FMoc-2-(5'-pentenyl)alanine manufacturers
|
| | (R)-N-FMoc-2-(5'-pentenyl)alanine Basic information |
| Product Name: | (R)-N-FMoc-2-(5'-pentenyl)alanine | | Synonyms: | (R)-N-FMoc-2-(5'-pentenyl)alanine;(9H-Fluoren-9-yl)MethOxy]Carbonyl Alpha-Methyl-D-Gly(Hexenyl)-OH;(R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-methyloct-7-enoic acid;(R)-N-Fmoc-2-(5'-hexyl)alanine;(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-2-methyloct-7-enoic acid;(R)-N-Fmoc-2-(5'-pentenyl)alanine, >97%;(R)-2-(Fmoc-amino)-2-methyloct-7-enoic acid;7-Octenoic acid, 2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-2-methyl-, (2R)- | | CAS: | 288617-78-7 | | MF: | C24H27NO4 | | MW: | 393.48 | | EINECS: | | | Product Categories: | | | Mol File: | 288617-78-7.mol |  |
| | (R)-N-FMoc-2-(5'-pentenyl)alanine Chemical Properties |
| Boiling point | 605.3±55.0 °C(Predicted) | | density | 1.169±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.94±0.41(Predicted) | | Appearance | Colorless to light yellow Oil | | InChIKey | QVNDFQWCJFAEFY-XMMPIXPASA-N | | SMILES | C(O)(=O)[C@@](NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)(C)CCCCC=C |
| | (R)-N-FMoc-2-(5'-pentenyl)alanine Usage And Synthesis |
| | (R)-N-FMoc-2-(5'-pentenyl)alanine Preparation Products And Raw materials |
|