| Company Name: |
ChemPep, Inc. |
| Tel: |
+1 (888) 615-9178 / (561) 791-8787 |
| Email: |
service@chempep.com |
| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
(S)-N-FMoc-2-(5'-pentenyl)alanine manufacturers
|
| | (S)-N-FMoc-2-(5'-pentenyl)alanine Basic information |
| Product Name: | (S)-N-FMoc-2-(5'-pentenyl)alanine | | Synonyms: | (S)-N-FMoc-2-(5'-pentenyl)alanine;(S)-2-((((9H-Fluoren-9-yl)Methoxy)carbonyl)aMino)-2-Methyloct-7-enoic acid;(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-2-methyloct-7-enoic acid;(S)-N-Fmoc-2-(5'-pentenyl)alanine, >97%;(S)-N-Fmoc-2-(5'-hexyl)alanine;(9H-Fluoren-9-yl)MethOxy]Carbonyl Alpha-Methyl-Gly(Hexenyl)-OH;(S)-2-(Fmoc-amino)-2-methyloct-7-enoic acid;Fmoc-(S)-2-amino-2-methyloct-7-enoic acid | | CAS: | 288617-74-3 | | MF: | C24H27NO4 | | MW: | 393.48 | | EINECS: | | | Product Categories: | | | Mol File: | 288617-74-3.mol |  |
| | (S)-N-FMoc-2-(5'-pentenyl)alanine Chemical Properties |
| Boiling point | 605.3±55.0 °C(Predicted) | | density | 1.169±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.94±0.41(Predicted) | | Appearance | Off-white to light yellow Solid | | InChIKey | QVNDFQWCJFAEFY-DEOSSOPVSA-N | | SMILES | C(O)(=O)[C@](NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)(C)CCCCC=C |
| | (S)-N-FMoc-2-(5'-pentenyl)alanine Usage And Synthesis |
| Uses | (S)-N-FMoc-2-(5'-pentenyl)alanine, also known as Fmoc-(S)-2-(5-hexenyl)alanine or (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-methyloct-7-enoic acid, is utilized in the preparation of stapled peptides by ring closing metathesis. Store at -4 C. |
| | (S)-N-FMoc-2-(5'-pentenyl)alanine Preparation Products And Raw materials |
|