| Company Name: |
Sichuan BioCrick Biotech Co., Ltd Gold
|
| Tel: |
28-86-28-8543-3893 13260669172 |
| Email: |
sales@biocrick.com |
| Products Intro: |
Product Name:Isoerysenegalensein E
CAS:478158-77-9
Purity:98% HPLC Package:5mg;10mg;20mg;50mg……1g
|
| Company Name: |
BioBioPha Co., Ltd.
|
| Tel: |
0871-65217109 13211707573; |
| Email: |
y.liu@mail.biobiopha.com |
| Products Intro: |
Product Name:Isoerysenegalensein E
CAS:478158-77-9
Purity:>97.0% Package:5mg Remarks:BBP02812
|
| Company Name: |
Sichuan Wei Keqi Biological Technology Co., Ltd.
|
| Tel: |
028-81700200 18116577057 |
| Email: |
3003855609@qq.com |
| Products Intro: |
Product Name:IsoerysenegalenseinE
CAS:478158-77-9
Purity:98% Package:5mg；10mg；20mg；50mg；100mg；200mg；500mg；1g
|
|
| | Isoerysenegalensein E Basic information |
| Product Name: | Isoerysenegalensein E | | Synonyms: | Isoerysenegalensein E;4H-1-Benzopyran-4-one, 5,7-dihydroxy-6-(2-hydroxy-3-methyl-3-buten-1-yl)-3-(4-hydroxyphenyl)-8-(3-methyl-2-buten-1-yl)- | | CAS: | 478158-77-9 | | MF: | C25H26O6 | | MW: | 422.47 | | EINECS: | | | Product Categories: | | | Mol File: | 478158-77-9.mol |  |
| | Isoerysenegalensein E Chemical Properties |
| InChI | InChI=1S/C25H26O6/c1-13(2)5-10-17-22(28)18(11-20(27)14(3)4)23(29)21-24(30)19(12-31-25(17)21)15-6-8-16(26)9-7-15/h5-9,12,20,26-29H,3,10-11H2,1-2,4H3 | | InChIKey | MHYBVRYBSLBMGT-UHFFFAOYSA-N | | SMILES | C1OC2=C(C/C=C(/C)\C)C(O)=C(CC(O)C(C)=C)C(O)=C2C(=O)C=1C1=CC=C(O)C=C1 |
| | Isoerysenegalensein E Usage And Synthesis |
| Uses | Isoerysenegalensein E (compound 3) is a natural product that can be found in Erythrina lysistemon[1]. | | References | [1] el-Masry S, et al. Prenylated flavonoids of Erythrina lysistemon grown in Egypt. Phytochemistry. 2002 Aug;60(8):783-7. DOI:10.1016/s0031-9422(02)00202-9 |
| | Isoerysenegalensein E Preparation Products And Raw materials |
|