|
|
| | IODOACETIC ACID SODIUM SALT Basic information |
| Product Name: | IODOACETIC ACID SODIUM SALT | | Synonyms: | IODOACETIC ACID SODIUM SALT;SODIUM MONOIODOACETATE;SODIUM IODACETATE SODIUM SALT;SODIUM IODOACETATE, SIGMAULTRA;IODOACETIC ACID SODIUM APPROX. 99%;SodiumIodoacetate,>98%;IODOACETICACIDSODIUMSALT,REAGENT;meet standard | | CAS: | 305-53-3 | | MF: | C2H2INaO2 | | MW: | 207.93 | | EINECS: | 206-165-7 | | Product Categories: | | | Mol File: | 305-53-3.mol |  |
| | IODOACETIC ACID SODIUM SALT Chemical Properties |
| Melting point | 208 °C (dec.)(lit.) | | storage temp. | -20°C | | solubility | methanol: 0.1 M at 20 °C, clear, colorless | | form | Powder | | color | Light yellow to yellow-brown | | biological source | synthetic (organic) | | Water Solubility | water: 100mg/mL | | BRN | 4009322 | | InChI | InChI=1S/C2H3IO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1 | | InChIKey | AGDSCTQQXMDDCV-UHFFFAOYSA-M | | SMILES | C([O-])(=O)CI.[Na+] | | CAS DataBase Reference | 305-53-3(CAS DataBase Reference) | | EPA Substance Registry System | Acetic acid, iodo-, sodium salt (305-53-3) | | Absorption | cut-off at 335nm in methanol at 0.1M |
| Hazard Codes | T,Xn | | Risk Statements | 25-37/38-41-20/21/22-36/37/38 | | Safety Statements | 26-39-45-36-36/37/39-22 | | RIDADR | UN 2811 6.1/PG 1 | | WGK Germany | 3 | | RTECS | AI3675000 | | F | 3-8-10 | | TSCA | TSCA listed | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29159000 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Corr. 1B |
| | IODOACETIC ACID SODIUM SALT Usage And Synthesis |
| Chemical Properties | light yellow to yellow-brown powder | | Uses | Analytical reagent. | | Uses | Reagent for the modification of cysteine residues in proteins. Used to induce animal osteoarthritis model system, which mimics both symptoms and histopathology of the human disease. | | Hazard | Toxic. | | Biochem/physiol Actions | Used to induce osteoarthritis-like lesions and functional impairment in rats, for testing of chondroprotective agents and diagnostic imaging techniques. | | Safety Profile | Poison by ingestion and intraperitoneal routes. Experimental reproductive effects. Human mutation data reported. When heated to decomposition it emits toxic fumes of Iand Na2O. |
| | IODOACETIC ACID SODIUM SALT Preparation Products And Raw materials |
|