Afatinib iMpurity manufacturers
- Afatinib impurity D
-
-
2026-03-12
- CAS:1680184-59-1
- Min. Order: 10mg
- Purity: 98%
- Supply Ability: 500mg
|
| | Afatinib iMpurity Basic information |
| Product Name: | Afatinib iMpurity | | Synonyms: | (2Z)-Afatinib;Afatinib (Z)-Isomer;Cis-Afatinib;2-Butenamide, N-[4-[(3-chloro-4-fluorophenyl)amino]-7-[[(3S)-tetrahydro-3-furanyl]oxy]-6-quinazolinyl]-4-(dimethylamino)-, (2Z)-;Afatinib Impurity 18（(2Z) Afatinib）;1-(4-((3-chloro-4-fluorophenyl)amino)-7-(((S)-tetrahydrofuran-2-yl)oxy)quinazolin-6-yl)-5-hydroxypyrrolidin-2-one;Afatinib Impurity B (2Z)-Afatinib;Z-Afatinib? (Afatinib Impurity） | | CAS: | 1680184-59-1 | | MF: | C24H25ClFN5O3 | | MW: | 485.94 | | EINECS: | | | Product Categories: | | | Mol File: | 1680184-59-1.mol |  |
| | Afatinib iMpurity Chemical Properties |
| Melting point | >134°C (dec.) | | Boiling point | 676.9±55.0 °C(Predicted) | | density | 1.380±0.06 g/cm3(Predicted) | | storage temp. | Amber Vial, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 11.79±0.43(Predicted) | | color | Pale Yellow to Light Yellow | | Stability: | Light Sensitive | | InChIKey | ULXXDDBFHOBEHA-QGZUEGPWSA-N | | SMILES | C(NC1C(O[C@H]2CCOC2)=CC2C(C=1)=C(NC1=CC=C(F)C(Cl)=C1)N=CN=2)(=O)/C=C\CN(C)C |
| | Afatinib iMpurity Usage And Synthesis |
| Uses | (2Z)-Afatinib is a structural analogue of Afatinib (A355300), an aminocrotonylamino-substituted quinazoline derivative used for treating cancer and diseases of the respiratory tract, lungs, gastrointestinal tract, bile duct, and gallbladder. |
| | Afatinib iMpurity Preparation Products And Raw materials |
|