|
|
| | 2,5-Diazabicyclo[4.1.0]heptane-2-carboxylic Acid DiMethylethyl Ester Basic information |
| Product Name: | 2,5-Diazabicyclo[4.1.0]heptane-2-carboxylic Acid DiMethylethyl Ester | | Synonyms: | 2,5-Diazabicyclo[4.1.0]heptane-2-carboxylic Acid DiMethylethyl Ester;Tert-Butyl 2,5-Diazabicyclo[4.1.0]Heptane-2-Carboxylate;Tert-Butyl 2,5-Diazabicyclo[4.1.0]Heptane-2-Carboxylate(WX110886);2,5-Diaza-bicyclo[4.1.0]heptane-2-carboxylic acid tert-butyl ester;2,5-Diazabicyclo[4.1.0]heptane-2-carboxylic acid, 1,1-dimethylethyl ester;tert-butyl (1S,6R)-2,5-diazabicyclo[4.1.0]heptane-2-carboxylate;tert-butyl 2,5-diazabicyclo[4.1.0]heptane-5-carboxylate;2-Boc-2,5-diazabicyclo[4.1.0]heptane | | CAS: | 1228675-18-0 | | MF: | C10H18N2O2 | | MW: | 198.26 | | EINECS: | | | Product Categories: | Amines, Heterocycles, Miscellaneous Reagents | | Mol File: | 1228675-18-0.mol | ![2,5-Diazabicyclo[4.1.0]heptane-2-carboxylic Acid DiMethylethyl Ester Structure](CAS/GIF/1228675-18-0.gif) |
| | 2,5-Diazabicyclo[4.1.0]heptane-2-carboxylic Acid DiMethylethyl Ester Chemical Properties |
| Boiling point | 276.4±15.0 °C(Predicted) | | density | 1.104±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 9.54±0.20(Predicted) | | Appearance | Light yellow to brown Liquid | | InChI | InChI=1S/C10H18N2O2/c1-10(2,3)14-9(13)12-5-4-11-7-6-8(7)12/h7-8,11H,4-6H2,1-3H3 | | InChIKey | MALCQJIQWIWGOV-UHFFFAOYSA-N | | SMILES | C12C(C1)NCCN2C(OC(C)(C)C)=O |
| | 2,5-Diazabicyclo[4.1.0]heptane-2-carboxylic Acid DiMethylethyl Ester Usage And Synthesis |
| Uses | 2,5-Diazabicyclo[4.1.0]heptane-2-carboxylic Acid Dimethylethyl Ester is used in the synthesis of piperazines which show pharmacological activity and also a Ciprofloxacin analogue. |
| | 2,5-Diazabicyclo[4.1.0]heptane-2-carboxylic Acid DiMethylethyl Ester Preparation Products And Raw materials |
|