| Company Name: |
AAB-PHARMA LIMITED Gold |
| Tel: |
025-66800956 18800000000 |
| Email: |
sales@njdmchem.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Chloro-3-methoxyphenol Basic information |
| | 4-Chloro-3-methoxyphenol Chemical Properties |
| Melting point | 79-80 °C | | Boiling point | 141-150 °C(Press: 18 Torr) | | density | 1.280±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | crystalline powder | | pka | 9.14±0.18(Predicted) | | color | Off white to faint peach | | InChI | InChI=1S/C7H7ClO2/c1-10-7-4-5(9)2-3-6(7)8/h2-4,9H,1H3 | | InChIKey | NKFRBXPBRPYULV-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(Cl)C(OC)=C1 |
| | 4-Chloro-3-methoxyphenol Usage And Synthesis |
| | 4-Chloro-3-methoxyphenol Preparation Products And Raw materials |
|