| Company Name: |
Cool Pharm, Ltd |
| Tel: |
021-60455363 18019463053 |
| Email: |
sales@coolpharm.com |
|
| | Methyl 2-Boc-2-aza-spiro[3.3]heptane-6-carboxylate Basic information |
| Product Name: | Methyl 2-Boc-2-aza-spiro[3.3]heptane-6-carboxylate | | Synonyms: | Methyl 2-Boc-2-aza-spiro[3.3]heptane-6-carboxylate;Methyl 2-Boc-2-aza-spiro[3.3]heptane-6-carboxylate - M11808;2-Azaspiro[3.3]heptane-2,6-dicarboxylic acid, 2-(1,1-dimethylethyl) 6-methyl ester;Methvl 2-Boc-2-aza-spirol3.3]heptane-6-carboxylate;2-tert-butyl 6-methyl 2-azaspiro[3.3]heptane-2,6-dicarboxylate | | CAS: | 1408074-81-6 | | MF: | C13H21NO4 | | MW: | 255.31 | | EINECS: | | | Product Categories: | | | Mol File: | 1408074-81-6.mol | ![Methyl 2-Boc-2-aza-spiro[3.3]heptane-6-carboxylate Structure](CAS/20150408/GIF/1408074-81-6.gif) |
| | Methyl 2-Boc-2-aza-spiro[3.3]heptane-6-carboxylate Chemical Properties |
| Boiling point | 328.9±42.0 °C(Predicted) | | density | 1.15±0.1 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | -1.37±0.40(Predicted) | | Appearance | Off-white to light yellow Solid-Liquid Mixture | | InChI | InChI=1S/C13H21NO4/c1-12(2,3)18-11(16)14-7-13(8-14)5-9(6-13)10(15)17-4/h9H,5-8H2,1-4H3 | | InChIKey | FZDJDEXABKVIDA-UHFFFAOYSA-N | | SMILES | C1C2(CC(C(OC)=O)C2)CN1C(OC(C)(C)C)=O |
| | Methyl 2-Boc-2-aza-spiro[3.3]heptane-6-carboxylate Usage And Synthesis |
| Uses | 2-Tert-Butyl 6-Methyl 2-Azaspiro[3.3]Heptane-2,6-Dicarboxylate (cas# 1408074-81-6) is a building block to BRD9 inhibitor compounds for treating Cancer or Viral infections. |
| | Methyl 2-Boc-2-aza-spiro[3.3]heptane-6-carboxylate Preparation Products And Raw materials |
|