| Company Name: |
SPIRO PHARMA |
| Tel: |
|
| Email: |
eric_feng1954@126.com |
|
| | 2-Azaspiro[3.3]heptane-2-carboxylic acid, 6-forMyl-, 1,1-diMethylethyl ester Basic information |
| Product Name: | 2-Azaspiro[3.3]heptane-2-carboxylic acid, 6-forMyl-, 1,1-diMethylethyl ester | | Synonyms: | 2-Azaspiro[3.3]heptane-2-carboxylic acid, 6-forMyl-, 1,1-diMethylethyl ester;tert-butyl 2-Formyl-6-azaspiro[3.3]heptane-6-carboxylate;6-Formyl-2-aza-spiro[3.3]heptane-2-carboxylic acid tert-butyl ester;tert-butyl 2-Formyl-6-azaspiro[3.3]heptane-6-carboxylate - F11069;2-Boc-2-azaspiro[3.3]heptane-6-carbaldehyde;tert-butyl 6-formyl-2-azaspiro[3.3]heptane-2-carboxylate | | CAS: | 1440960-67-7 | | MF: | C12H19NO3 | | MW: | 225.28 | | EINECS: | | | Product Categories: | | | Mol File: | 1440960-67-7.mol | ![2-Azaspiro[3.3]heptane-2-carboxylic acid, 6-forMyl-, 1,1-diMethylethyl ester Structure](CAS/20150408/GIF/1440960-67-7.gif) |
| | 2-Azaspiro[3.3]heptane-2-carboxylic acid, 6-forMyl-, 1,1-diMethylethyl ester Chemical Properties |
| Boiling point | 318.7±42.0 °C(Predicted) | | density | 1.13±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | pka | -1.28±0.40(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C12H19NO3/c1-11(2,3)16-10(15)13-7-12(8-13)4-9(5-12)6-14/h6,9H,4-5,7-8H2,1-3H3 | | InChIKey | QAIHVJYVIUKZAR-UHFFFAOYSA-N | | SMILES | C1C2(CC(C=O)C2)CN1C(OC(C)(C)C)=O |
| | 2-Azaspiro[3.3]heptane-2-carboxylic acid, 6-forMyl-, 1,1-diMethylethyl ester Usage And Synthesis |
| | 2-Azaspiro[3.3]heptane-2-carboxylic acid, 6-forMyl-, 1,1-diMethylethyl ester Preparation Products And Raw materials |
|