| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Ethylenediamine sulfate manufacturers
|
| | Ethylenediamine sulfate Basic information |
| Product Name: | Ethylenediamine sulfate | | Synonyms: | ETHYLENEDIAMMONIUM SULFATE;1-2-DIAMINOETHANE SULFATE;1,2-Ethanediamine,sulfate(1:1);ETHYLENEDIAMMONIUM SULFATE 97+%;ethylenediamine sulphate (1:1);EthylenediaMine Monosulfate;EthylenediamineSulfate>;ETHYLENEDIAMMONIUM SULFATE FOR SYNTHESIS | | CAS: | 22029-36-3 | | MF: | C2H10N2O4S | | MW: | 158.17 | | EINECS: | 244-733-6 | | Product Categories: | | | Mol File: | 22029-36-3.mol |  |
| | Ethylenediamine sulfate Chemical Properties |
| Melting point | 225-228°C | | storage temp. | Store below +30°C. | | form | powder to crystal | | color | White to Almost white | | Water Solubility | almost transparency | | InChI | 1S/C2H8N2.H2O4S/c3-1-2-4;1-5(2,3)4/h1-4H2;(H2,1,2,3,4) | | InChIKey | BNZCDZDLTIHJAC-UHFFFAOYSA-N | | SMILES | [S](=O)(=O)([O-])[O-].[N+H3]CC[N+H3] | | EPA Substance Registry System | 1,2-Ethanediamine, sulfate (1:1) (22029-36-3) |
| RIDADR | 2811 | | WGK Germany | WGK 2 | | RTECS | KV5425000 | | TSCA | TSCA listed | | HS Code | 2921.21.0000 | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 11 - Combustible Solids |
| | Ethylenediamine sulfate Usage And Synthesis |
| | Ethylenediamine sulfate Preparation Products And Raw materials |
|