|
|
| | 3-(3-Chloro-phenyl)-isoxazole-5-carbaldehyde Basic information |
| | 3-(3-Chloro-phenyl)-isoxazole-5-carbaldehyde Chemical Properties |
| form | solid | | InChI | 1S/C10H6ClNO2/c11-8-3-1-2-7(4-8)10-5-9(6-13)14-12-10/h1-6H | | InChIKey | TZCHLLPQCIJQJS-UHFFFAOYSA-N | | SMILES | Clc1cccc(c1)-c2cc(C=O)on2 |
| Hazard Codes | Xi | | Risk Statements | 43 | | Safety Statements | 36/37 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |
| | 3-(3-Chloro-phenyl)-isoxazole-5-carbaldehyde Usage And Synthesis |
| | 3-(3-Chloro-phenyl)-isoxazole-5-carbaldehyde Preparation Products And Raw materials |
|