| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Methyl 4,6-dichloro-2-(methylthio)pyrimidine-5-carboxylate Basic information |
| Product Name: | Methyl 4,6-dichloro-2-(methylthio)pyrimidine-5-carboxylate | | Synonyms: | Methyl 4,6-dichloro-2-(methylthio)pyrimidine-5-carboxylate;Methyl 4,6-dichloro-2-(methylsulfanyl)-5-pyrimidinecarboxylate;Methyl 4,6-dichloro-2-(methylthio)pyrimidine-5-carboxylate 97%;5-Pyrimidinecarboxylic acid, 4,6-dichloro-2-(methylthio)-, methyl ester;methyl 4,6?dichloro?2?(methylsulfanyl)pyrimidine?5?carboxylate | | CAS: | 883870-28-8 | | MF: | C7H6Cl2N2O2S | | MW: | 253.11 | | EINECS: | | | Product Categories: | | | Mol File: | 883870-28-8.mol |  |
| | Methyl 4,6-dichloro-2-(methylthio)pyrimidine-5-carboxylate Chemical Properties |
| Melting point | 50-55°C | | Boiling point | 343.5±37.0 °C(Predicted) | | density | 1.53±0.1 g/cm3(Predicted) | | Fp | >110℃ | | pka | -6.58±0.39(Predicted) | | form | solid | | InChI | 1S/C7H6Cl2N2O2S/c1-13-6(12)3-4(8)10-7(14-2)11-5(3)9/h1-2H3 | | InChIKey | XURMLXHLZQXOFN-UHFFFAOYSA-N | | SMILES | COC(=O)c1c(Cl)nc(SC)nc1Cl |
| Hazard Codes | Xi | | Risk Statements | 36/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2 |
| | Methyl 4,6-dichloro-2-(methylthio)pyrimidine-5-carboxylate Usage And Synthesis |
| | Methyl 4,6-dichloro-2-(methylthio)pyrimidine-5-carboxylate Preparation Products And Raw materials |
|