4-chloro-2-(methylthio)pyrimidine-5-carboxylic acid manufacturers
|
| | 4-chloro-2-(methylthio)pyrimidine-5-carboxylic acid Basic information |
| Product Name: | 4-chloro-2-(methylthio)pyrimidine-5-carboxylic acid | | Synonyms: | 4-Chloro-2-(methylthio)-5-pyrimidinecarboxylic acid;4-chloro-2-(methylthio)pyrimidine-5-carboxylic acid;4-Chloro-2-methylsulfanyl-pyrimidine-5-carboxylic acid;4-Chloro-2-(methylthio);5-Pyrimidinecarboxylic acid, 4-chloro-2-(methylthio)-;4-Chloro-2-(methylthio)pyrimidine-5-carboxylicaci;4-chloro-2-(methylthio)pyrimidine-5-carboxylic acid ISO 9001：2015 REACH;3-chloro-5-(methylthio)pyrazine-2-carboxylic acid | | CAS: | 74840-34-9 | | MF: | C6H5ClN2O2S | | MW: | 204.63 | | EINECS: | | | Product Categories: | | | Mol File: | 74840-34-9.mol |  |
| | 4-chloro-2-(methylthio)pyrimidine-5-carboxylic acid Chemical Properties |
| Boiling point | 380.9±22.0 °C(Predicted) | | density | 1.59 | | storage temp. | -20°C, stored under nitrogen, away from moisture | | pka | 1.36±0.32(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H5ClN2O2S/c1-12-6-8-2-3(5(10)11)4(7)9-6/h2H,1H3,(H,10,11) | | InChIKey | MYNMNRVNVCHWIT-UHFFFAOYSA-N | | SMILES | C1(SC)=NC=C(C(O)=O)C(Cl)=N1 |
| | 4-chloro-2-(methylthio)pyrimidine-5-carboxylic acid Usage And Synthesis |
| | 4-chloro-2-(methylthio)pyrimidine-5-carboxylic acid Preparation Products And Raw materials |
|