|
|
| | (1S,2S)-(+)-2-Benzyloxycyclohexylamine Basic information |
| Product Name: | (1S,2S)-(+)-2-Benzyloxycyclohexylamine | | Synonyms: | (1S-TRANS)-2-(PHENYLMETHOXY)CYCLOHEXANEAMINE;(1S,2S)-(+)-2-BENZYLOXYCYCLOHEXYLAMINE;(1S,2S)-2-(Phenylmethoxy)cyclohexanamine;(1S)-trans-(+)-2-(Phenylmethoxy)cyclohexanamine;(1S,2S)-(+)-1-Amino-2-benzyloxycyclohexane;(1S-trans)-2-(Phenylmethoxy) cyclohexaminetaneamine;(1S,2S)-(+)-2-BENZYLOXYCYCLOHEXYLAMINE: CHIPROS 99%;(1S,2S)-(+)-2-BENZYLOXYCYCLOHEXYLAMINE, CHIPROS 99+%, EE 99% | | CAS: | 216394-07-9 | | MF: | C13H19NO | | MW: | 205.3 | | EINECS: | 606-811-1 | | Product Categories: | CHIRAL CHEMICALS | | Mol File: | 216394-07-9.mol |  |
| | (1S,2S)-(+)-2-Benzyloxycyclohexylamine Chemical Properties |
| Boiling point | 79-80°C 0,08mm | | density | 1.02 | | refractive index | 1.5275 | | Fp | 79-80°C/0.08mm | | storage temp. | 2-8°C | | pka | 9.80±0.70(Predicted) | | form | solid | | Sensitive | Air Sensitive | | BRN | 8981794 | | InChI | 1S/C13H19NO/c14-12-8-4-5-9-13(12)15-10-11-6-2-1-3-7-11/h1-3,6-7,12-13H,4-5,8-10,14H2/t12-,13-/m0/s1 | | InChIKey | NTHNRYLIXJZHRZ-STQMWFEESA-N | | SMILES | N[C@H]1CCCC[C@@H]1OCc2ccccc2 |
| Hazard Codes | Xn | | Risk Statements | 34-36/37/38-22 | | Safety Statements | 26-36/37/39-45 | | RIDADR | 2735 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (1S,2S)-(+)-2-Benzyloxycyclohexylamine Usage And Synthesis |
| | (1S,2S)-(+)-2-Benzyloxycyclohexylamine Preparation Products And Raw materials |
|