| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:cis-1,8-DiaMino-p-Menthane
CAS:54166-24-4
Purity:98% Package:5G
|
| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:cis-1,8-Diamino-p-menthane
CAS:54166-24-4
Purity:97% Remarks:B37093
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:cis-1,8-Diamino-p-menthane
CAS:54166-24-4
Purity:98% Package:5G Remarks:469564-5G
|
| Company Name: |
Aikon International Limited
|
| Tel: |
025-58851090 15955137747 |
| Email: |
sales01@aikonchem.com |
| Products Intro: |
Product Name:cis-1,8-Diamino-p-methane
CAS:54166-24-4
Purity:95+% Package:1g;5g;10g
|
|
| | CIS-1,8-DIAMINO-P-METHANE Basic information |
| Product Name: | CIS-1,8-DIAMINO-P-METHANE | | Synonyms: | CIS-1,8-DIAMINO-P-METHANE;cis-1,8-diamino-P-menthane;cis-1,8-Diamino-p-menthane 98%;Cyclohexanemethanamine, 4-amino-α,α,4-trimethyl-, cis-;(1r,4r)-4-(2-aminopropan-2-yl)-1-methylcyclohexan-1-amine;cis-4-(2-Aminopropan-2-yl)-1-methylcyclohexanamine;cis-1,8-Diamino-p-menthane | | CAS: | 54166-24-4 | | MF: | C10H22N2 | | MW: | 170.3 | | EINECS: | | | Product Categories: | Nitrogen Compounds;Organic Building Blocks;Polyamines | | Mol File: | 54166-24-4.mol |  |
| | CIS-1,8-DIAMINO-P-METHANE Chemical Properties |
| Boiling point | 233 °C (lit.) | | density | 0.918 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.48(lit.) | | Fp | 212 °F | | InChI | 1S/C10H22N2/c1-9(2,11)8-4-6-10(3,12)7-5-8/h8H,4-7,11-12H2,1-3H3/t8-,10+ | | InChIKey | KOGSPLLRMRSADR-WAAGHKOSSA-N | | SMILES | CC(C)(N)[C@H]1CC[C@@](C)(N)CC1 |
| Hazard Codes | T | | Risk Statements | 23/24/25-34 | | Safety Statements | 26-27-28-36/37/39-45 | | RIDADR | UN 2922 8/PG 2 | | WGK Germany | 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Oral
Eye Dam. 1
Skin Corr. 1B |
| | CIS-1,8-DIAMINO-P-METHANE Usage And Synthesis |
| Uses | cis-1,8-Diamino-p-menthane may be used in the synthesis of cis-(N,N′-p-menth-1,8-ylene)bis(2-bromo-3,3-dimethylbutanamide). | | General Description | cis-1,8-Diamino-p-menthane may be used in the synthesis of cis-(N,N′-p-menth-1,8-ylene)bis(2-bromo-3,3-dimethylbutanamide). |
| | CIS-1,8-DIAMINO-P-METHANE Preparation Products And Raw materials |
|