4-AMINO-4'-HYDROXYBIPHENYL manufacturers
- 4-AMINO-4'-HYDROXYBIPHENYL
-
- $10.00 / 1KG
-
2025-09-25
- CAS:1204-79-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 4-AMINO-4'-HYDROXYBIPHENYL Basic information | | Uses |
| | 4-AMINO-4'-HYDROXYBIPHENYL Chemical Properties |
| Melting point | 273°C | | Boiling point | 319.45°C (rough estimate) | | density | 1.0936 (rough estimate) | | refractive index | 1.5300 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 10.31±0.26(Predicted) | | Appearance | Light yellow to brown Solid | | InChI | InChI=1S/C12H11NO/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-8,14H,13H2 | | InChIKey | LQZZZAFQKXTFKH-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(N)C=C2)=CC=C(O)C=C1 |
| | 4-AMINO-4'-HYDROXYBIPHENYL Usage And Synthesis |
| Uses | 4'-Aminobiphenyl-4-Ol is a useful research chemical. | | Definition | ChEBI: An aminobiphenyl whose amino group is at C-4 and is hydroxylated at C-4'. |
| | 4-AMINO-4'-HYDROXYBIPHENYL Preparation Products And Raw materials |
|