|
|
| | 3-Bromo-5-chloro-1,2,4-thiadiazole Basic information | | Application |
| Product Name: | 3-Bromo-5-chloro-1,2,4-thiadiazole | | Synonyms: | 3-Bromo-5-chloro-1,2,4-thiadiazole,97%;1,2,4-Thiadiazole,3-broMo-5-chloro-;3-BroMo-5-chloro-1,2,4-thiadiazole, 97% 10GR;3-bromo-5-chloro-1,2,4-thiadiazole1-phenylethanamine;TIANFU CHEM 37159-60-7 3-BROMO-5-CHLORO-1,2,4-THIADIAZOLE;3-Bromo-5-chloro-1,2,4-thiadiazole | | CAS: | 37159-60-7 | | MF: | C2BrClN2S | | MW: | 199.46 | | EINECS: | | | Product Categories: | | | Mol File: | 37159-60-7.mol |  |
| | 3-Bromo-5-chloro-1,2,4-thiadiazole Chemical Properties |
| Melting point | 24-25 °C | | Boiling point | 192-194 °C | | density | 2.161 (estimate) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | form | Liquid | | pka | -3.72±0.10(Predicted) | | color | Clear colorless to yellow | | InChI | InChI=1S/C2BrClN2S/c3-1-5-2(4)7-6-1 | | InChIKey | CXUWGEWQRCXJDC-UHFFFAOYSA-N | | SMILES | S1C(Cl)=NC(Br)=N1 | | CAS DataBase Reference | 37159-60-7 |
| Provider | Language |
|
ACROS
| English |
| | 3-Bromo-5-chloro-1,2,4-thiadiazole Usage And Synthesis |
| Application | 3-Bromo-5-chloro-1,2,4-thiadiazole is a heterocyclic organic compound that can be used as an organic intermediate. | | Chemical Properties | clear colorless to yellow liquid | | Synthesis | 3-Bromo-5-chloro-1,2,4-thiadiazole can be used to prepare 3-bromo-1,2,4-thiadiazol-5-amine and 1,2,4-thiadiazole-based OLED emissive layer materials. |
| | 3-Bromo-5-chloro-1,2,4-thiadiazole Preparation Products And Raw materials |
|