| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (+)-tert-Butyl D-lactate Basic information |
| Product Name: | (+)-tert-Butyl D-lactate | | Synonyms: | tert-Butyl (R)-(+)-lactate;(+)-tert-Butyl D-lactate >=99.0% (sum of enantiomers, GC);tert-Butyl (2R)-2-hydroxypropanoate;(R)-(+)-Lactic acid tert-butyl ester;(R)-tert-Butyl 2-hydroxypropanoate;Propanoic acid, 2-hydroxy-, 1,1-dimethylethyl ester, (2R)-;tert-butyl (R)-2-hydroxypropanoate;ert-butyl(2R)-2-hydroxypropanoate | | CAS: | 68166-83-6 | | MF: | C7H14O3 | | MW: | 146.18 | | EINECS: | | | Product Categories: | Chiral Building Blocks;Esters;Organic Building Blocks | | Mol File: | 68166-83-6.mol |  |
| | (+)-tert-Butyl D-lactate Chemical Properties |
| Melting point | 38-42 °C | | Boiling point | 161.8±8.0 °C(Predicted) | | density | 1.004±0.06 g/cm3(Predicted) | | Fp | 113 °C | | storage temp. | 2-8°C | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | pka | 13.07±0.20(Predicted) | | form | Solid | | color | Off-White | | Optical Rotation | [α]20/D +7.3±0.5°, c = 1.7% in methylene chloride | | BRN | 1722069 | | InChI | InChI=1S/C7H14O3/c1-5(8)6(9)10-7(2,3)4/h5,8H,1-4H3/t5-/m1/s1 | | InChIKey | IXXMVXXFAJGOQO-RXMQYKEDSA-N | | SMILES | C(OC(C)(C)C)(=O)[C@H](O)C |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 3 | | Storage Class | 11 - Combustible Solids |
| | (+)-tert-Butyl D-lactate Usage And Synthesis |
| Uses | (R)-tert-Butyl 2-hydroxypropanoate is an intermediate used in the stereo controlled synthesis of hydroxy carboxylic acids from L-amino acids. |
| | (+)-tert-Butyl D-lactate Preparation Products And Raw materials |
|