| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Decane-d22, 99 atom%D CAS:16416-29-8 Package:1ML
|
| Company Name: |
Shandong Xiya Chemical Co., Ltd
|
| Tel: |
13355009207 13355009207 |
| Email: |
3007715519@qq.com |
| Products Intro: |
CAS:16416-29-8 Purity:>=98.0% Package:1G
|
| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:n-Decane-d22 CAS:16416-29-8 Remarks:CS-C-00006
|
|
| | N-DECANE-D22 Basic information |
| Product Name: | N-DECANE-D22 | | Synonyms: | perdeuterodecane(deuterateddecane);DECANE-D22, 99 ATOM % D;deuterationdegree;Decane-D22 >99.0 Atom % D;n-Decane-D22 deuteration degree min. 99% for NMR spectroscopy MagniSolv;N-DECANE (D22, 99%) 97% CHEMICAL PURITY;DECANE-D 22;N-DECANE-D22 | | CAS: | 16416-29-8 | | MF: | C10D22 | | MW: | 164.42 | | EINECS: | | | Product Categories: | Alphabetical Listings;D;Stable Isotopes | | Mol File: | 16416-29-8.mol |  |
| | N-DECANE-D22 Chemical Properties |
| Melting point | −30 °C(lit.) | | Boiling point | 174 °C(lit.) | | density | 0.842 g/mL at 25 °C | | refractive index | n20/D 1.407(lit.) | | Fp | 115 °F | | storage temp. | Store below +30°C. | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless | | explosive limit | 0.7-5.4%(V) | | Sensitive | Hygroscopic | | Stability: | Stable. Combustible - incompatible with strong oxidizing agents. Hygroscopic - protect from moisture. | | InChI | 1S/C10H22/c1-3-5-7-9-10-8-6-4-2/h3-10H2,1-2H3/i1D3,2D3,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2 | | InChIKey | DIOQZVSQGTUSAI-DNYWURFXSA-N | | SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] | | EPA Substance Registry System | n-Decane-d22 (16416-29-8) | | CAS Number Unlabeled | 124-18-5 |
| Hazard Codes | Xi,F,Xn | | Risk Statements | 10-36/37/38-65 | | Safety Statements | 16-26-36-62 | | RIDADR | UN 2247 3/PG 3 | | WGK Germany | 3 | | HS Code | 28459000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Asp. Tox. 1 Flam. Liq. 3 |
| | N-DECANE-D22 Usage And Synthesis |
| Chemical Properties | colourless liquid | | Uses | N-Decane-d22 was useful for neutron imaging of liquid swelling and surface phenomena during methane absorption in ethanol and n-decane under high pressure. |
| | N-DECANE-D22 Preparation Products And Raw materials |
|