|
|
| | H-L-Cys(Trt)-OtBu*HCl Basic information |
| Product Name: | H-L-Cys(Trt)-OtBu*HCl | | Synonyms: | H-L-Cys(Trt)-OtBu*HCl;S-Trityl-L-cystinetert-butyl ester hydrochloride≥ 99% (HPLC);H-Cys(Trt)-OtBu·HCl;tert-butyl (2R)-2-amino-3-[(triphenylmethyl)sulfanyl]propanoate hydrochloride;S-Trityl-L-Cysteine tert-butyl ester hydrochloride;S-(Triphenylmethyl)-L-cysteine 1,1-Dimethylethyl Ester Hydrochloride;tert-butyl S-trityl-L-cysteinate hydrochloride;tert-butyl (R)-2-amino-3-[(triphenylmethyl)sulfanyl]propanoate hydrochloride | | CAS: | 158009-03-1 | | MF: | C26H29NO2S | | MW: | 419.57896 | | EINECS: | | | Product Categories: | | | Mol File: | 158009-03-1.mol |  |
| | H-L-Cys(Trt)-OtBu*HCl Chemical Properties |
| storage temp. | Store at room temperature | | Appearance | White to light yellow Solid | | InChI | InChI=1/C26H29NO2S/c1-25(2,3)29-24(28)23(27)19-30-26(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22/h4-18,23H,19,27H2,1-3H3/t23-/s3 | | InChIKey | VVIZBZVUAOGUBQ-CRPMJUFNNA-N | | SMILES | C1(C=CC=CC=1)C(C1C=CC=CC=1)(C1C=CC=CC=1)SC[C@H](N)C(=O)OC(C)(C)C |&1:21,r| |
| | H-L-Cys(Trt)-OtBu*HCl Usage And Synthesis |
| Chemical Properties | White powder | | Uses | S-(Triphenylmethyl)-L-cysteine 1,1-Dimethylethyl Ester Hydrochloride is used as a reactant in the development of a peptidomimetic ligand to be used in affinity chromatography. |
| | H-L-Cys(Trt)-OtBu*HCl Preparation Products And Raw materials |
|