| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | tert-butyl 4-cyclopentylpiperazine-1-carboxylate Basic information |
| | tert-butyl 4-cyclopentylpiperazine-1-carboxylate Chemical Properties |
| Boiling point | 333.0±35.0 °C(Predicted) | | density | 1.068±0.06 g/cm3(Predicted) | | pka | 7.52±0.70(Predicted) | | form | solid | | InChI | 1S/C14H26N2O2/c1-14(2,3)18-13(17)16-10-8-15(9-11-16)12-6-4-5-7-12/h12H,4-11H2,1-3H3 | | InChIKey | PQQBTWGMGBONEQ-UHFFFAOYSA-N | | SMILES | O=C(OC(C)(C)C)N1CCN(C2CCCC2)CC1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | tert-butyl 4-cyclopentylpiperazine-1-carboxylate Usage And Synthesis |
| Uses | 4-(Cyclopentyl)piperazine-1-carboxylate-d9 tert-Butyl Ester is an intermediate in the synthesis of 1-Cyclopentyl-4-nitrosopiperazine-d9 (C213797), an isotopically labeled compound of 1-Cyclopentyl-4-nitrosopiperazine (C213795). 1-Cyclopentyl-4-nitrosopiperazine is used in the green preparation of aminoazacyclic compounds via a new method of selective reduction. |
| | tert-butyl 4-cyclopentylpiperazine-1-carboxylate Preparation Products And Raw materials |
|