|
|
| | 1-Cyclopentylpiperazine Basic information |
| Product Name: | 1-Cyclopentylpiperazine | | Synonyms: | 1-CYCLOPENTYLPIPERAZINE;BUTTPARK 82\06-05;RARECHEM AH CK 0078;TIMTEC-BB SBB004031;N-CYCLOPENTYLPIPERAZINE;cyclopentylpiperazine;1-(Cyclopentyl)piperazine 98%;Piperazine, 1-cyclopentyl- (8CI,9CI) | | CAS: | 21043-40-3 | | MF: | C9H18N2 | | MW: | 154.25 | | EINECS: | | | Product Categories: | PIPERIDINE | | Mol File: | 21043-40-3.mol |  |
| | 1-Cyclopentylpiperazine Chemical Properties |
| Boiling point | 48 °C | | density | 0.989±0.06 g/cm3(Predicted) | | refractive index | 1.5000 to 1.5040 | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Sparingly) | | form | Oil to Gel | | pka | 9.28±0.10(Predicted) | | color | Colourless to Pale Yellow | | InChI | InChI=1S/C9H18N2/c1-2-4-9(3-1)11-7-5-10-6-8-11/h9-10H,1-8H2 | | InChIKey | PVMCQBPJKPMOKM-UHFFFAOYSA-N | | SMILES | N1(C2CCCC2)CCNCC1 | | CAS DataBase Reference | 21043-40-3(CAS DataBase Reference) |
| | 1-Cyclopentylpiperazine Usage And Synthesis |
| Uses | 1-Cyclopentylpiperazine is used in the synthesis of quinolines as a new class of imidazole-free H3 receptor antagonists. Also used to prepare a series of estrogen receptor modulators. |
| | 1-Cyclopentylpiperazine Preparation Products And Raw materials |
|