| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Ethyl 4'-hydroxy-4-biphenylcarboxylate Basic information |
| Product Name: | Ethyl 4'-hydroxy-4-biphenylcarboxylate | | Synonyms: | 1,1''-Bicyclo-4-hexanone-4''-carboxylic acid ethyl ester;Ethyl 4'-hydroxy[1,1'-biphenyl]-4-carboxylate;4-(4-Ethoxycarbonylphenyl)phenol;4Hydroxy-4-biphenyl-4-carboxylic acid ethyl ester;Ethyl 4'-hydroxybiphenyl-4-carboxylate;[1,1'-Biphenyl]-4-carboxylic acid, 4'-hydroxy-, ethyl ester;ethyl 4-(4-hydroxyphenyl)benzoate;4'-Hydroxy-biphenyl-4-carboxylicacidethylester | | CAS: | 50670-76-3 | | MF: | C15H14O3 | | MW: | 242.27 | | EINECS: | | | Product Categories: | E-F;Stains and Dyes;Stains&Dyes, A to | | Mol File: | 50670-76-3.mol |  |
| | Ethyl 4'-hydroxy-4-biphenylcarboxylate Chemical Properties |
| Melting point | 142-144 °C (dec.)(lit.) | | Boiling point | 392.0±25.0 °C(Predicted) | | density | 1.167±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 9.56±0.26(Predicted) | | form | Solid | | color | White to light yellow | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C15H14O3/c1-2-18-15(17)13-5-3-11(4-6-13)12-7-9-14(16)10-8-12/h3-10,16H,2H2,1H3 | | InChIKey | FYXQIMAAEMCZLV-UHFFFAOYSA-N | | SMILES | CCOC(=O)c1ccc(cc1)-c2ccc(O)cc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Ethyl 4'-hydroxy-4-biphenylcarboxylate Usage And Synthesis |
| Uses | 4-(4-Ethoxycarbonylphenyl)phenol. Dyes and metabolites. |
| | Ethyl 4'-hydroxy-4-biphenylcarboxylate Preparation Products And Raw materials |
|