tert-butyl (7R)-7-methyl-1,4-diazepane-1-carboxylate manufacturers
|
| | tert-butyl (7R)-7-methyl-1,4-diazepane-1-carboxylate Basic information |
| Product Name: | tert-butyl (7R)-7-methyl-1,4-diazepane-1-carboxylate | | Synonyms: | tert-butyl (7R)-7-methyl-1,4-diazepane-1-carboxylate;Bis((2S,3S)-2,3-bis(benzoyloxy)butanedioic acid);1H-1,4-Diazepine-1-carboxylic acid, hexahydro-7-methyl-, 1,1-dimethylethyl ester, (7R)-;(R)-tert-Butyl 7-methyl-1,4-diazepane-1-carboxylate;(R)-4-Boc-5-methyl-1,4-diazepane;hemi((2S,3S)-2,3-dibenzoyloxybutanedioic acid);(R)-1-Boc-7-methyl-1,4-diazepane;Suvoley born impurities 3 | | CAS: | 1638743-92-6 | | MF: | C11H22N2O2 | | MW: | 214.3 | | EINECS: | | | Product Categories: | | | Mol File: | 1638743-92-6.mol |  |
| | tert-butyl (7R)-7-methyl-1,4-diazepane-1-carboxylate Chemical Properties |
| Boiling point | 288.3±23.0 °C(Predicted) | | density | 0.980±0.06 g/cm3(Predicted) | | storage temp. | Store at 0-8 °C | | pka | 10.47±0.40(Predicted) | | Appearance | colorless to yellow oil or liquid | | InChI | InChI=1S/C11H22N2O2/c1-9-5-6-12-7-8-13(9)10(14)15-11(2,3)4/h9,12H,5-8H2,1-4H3/t9-/m1/s1 | | InChIKey | DUYDMHWWVXLFDB-SECBINFHSA-N | | SMILES | N1(C(OC(C)(C)C)=O)[C@H](C)CCNCC1 |
| | tert-butyl (7R)-7-methyl-1,4-diazepane-1-carboxylate Usage And Synthesis |
| Uses | tert-Butyl (7R)-7-methyl-1,4-diazepane-1-carboxylate is used as a reactant in the preparation of Suvorexant, a medication for the treatment of insomnia. |
| | tert-butyl (7R)-7-methyl-1,4-diazepane-1-carboxylate Preparation Products And Raw materials |
|