|
|
| | 1H-1,4-Diazepine-1-carboxylic acid, hexahydro-5-Methyl-, phenylMethyl ester, (5R)- Basic information |
| Product Name: | 1H-1,4-Diazepine-1-carboxylic acid, hexahydro-5-Methyl-, phenylMethyl ester, (5R)- | | Synonyms: | (5R)-1H-1,4-Diazepine-1-carboxylic acid, hexahydro-5-Methyl-,phenylMethyl ester;1H-1,4-Diazepine-1-carboxylic acid, hexahydro-5-Methyl-, phenylMethyl ester, (5R)-;Suvorexant InterMediate;(R)-Benzyl 5-methyl-1,4-diazepane-1-carboxylate/Suvorexant intermediate;New Intermediates;(5R)-Hexahydro-5-methyl-1H-1,4-diazepine-1-carboxylic acid phenylmethyl ester;Benzyl (5R)-5-methyl-1,4-diazepane-1-carboxylate;Benzyl(R)-5-methyl-1,4-diazepane-1-carboxylate | | CAS: | 1001401-60-0 | | MF: | C14H20N2O2 | | MW: | 248.32 | | EINECS: | | | Product Categories: | | | Mol File: | 1001401-60-0.mol |  |
| | 1H-1,4-Diazepine-1-carboxylic acid, hexahydro-5-Methyl-, phenylMethyl ester, (5R)- Chemical Properties |
| Boiling point | 373.9±35.0 °C(Predicted) | | density | 1.081±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 10.49±0.40(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C14H20N2O2/c1-12-7-9-16(10-8-15-12)14(17)18-11-13-5-3-2-4-6-13/h2-6,12,15H,7-11H2,1H3/t12-/m1/s1 | | InChIKey | DQUGXUOXPVSJFN-GFCCVEGCSA-N | | SMILES | N1(C(OCC2=CC=CC=C2)=O)CC[C@@H](C)NCC1 |
| | 1H-1,4-Diazepine-1-carboxylic acid, hexahydro-5-Methyl-, phenylMethyl ester, (5R)- Usage And Synthesis |
| Synthesis | Benzyl (S)-5-methyl-1,4-diazepane-1-carboxylate and benzyl (R)-5-methyl-1,4-diazepane-1-carboxylate were prepared from benzyl (S)-5-methyl-1,4-diazepane-1-carboxylate and benzyl (R)-5-methyl-1,4-diazepane-1-carboxylate, respectively, by separating the racemic mixtures of the mixtures by chiral high performance liquid chromatography (HPLC). The procedure was as follows: a 10 cm Chiralpak AD column was used with 15% 1:1 MeOH/EtOH and 85% hexane (containing 0.1% diethylamine) as the mobile phase at a flow rate of 200 mL/min. 1.14 g of the first-eluting enantiomer (>95% ee) was obtained and 1.15 g of the second-eluting enantiomer (>95% ee) was obtained under these conditions. will The first eluted enantiomer was named B-2 and used in the subsequent reaction. | | References | [1] Patent: WO2008/8518, 2008, A1. Location in patent: Page/Page column 33 |
| | 1H-1,4-Diazepine-1-carboxylic acid, hexahydro-5-Methyl-, phenylMethyl ester, (5R)- Preparation Products And Raw materials |
|