|
|
| | 3-(3-Bromophenyl)propionic acid Basic information |
| | 3-(3-Bromophenyl)propionic acid Chemical Properties |
| Melting point | 72-76 °C | | Boiling point | 336.3±17.0 °C(Predicted) | | density | 1.531±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 4.58±0.10(Predicted) | | form | solid | | color | Off-white to light yellow | | Water Solubility | Insoluble in water. | | BRN | 2362753 | | InChI | InChI=1S/C9H9BrO2/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-3,6H,4-5H2,(H,11,12) | | InChIKey | DWKWMFSWLCIMKI-UHFFFAOYSA-N | | SMILES | C1(CCC(O)=O)=CC=CC(Br)=C1 | | CAS DataBase Reference | 42287-90-1(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 34-22-36/37/38 | | Safety Statements | 26-36/37/39-37 | | RIDADR | 3261 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| Provider | Language |
|
ALFA
| English |
| | 3-(3-Bromophenyl)propionic acid Usage And Synthesis |
| Uses | It is used in the synthesis and characterization of monoisomeric 1,8,15,22-substituted (A3B and A2B2) phthalocyanines and phthalocyanine-fullerene dyads. |
| | 3-(3-Bromophenyl)propionic acid Preparation Products And Raw materials |
|