| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3,5-Dibromo-L-tyrosine Basic information |
| Product Name: | 3,5-Dibromo-L-tyrosine | | Synonyms: | 3,5-Dibromo-L-tyrosine;H-PHE(3,5-BR2, 4-OH)-OH DIHYDRATE;H-TYR(3,5-BR 2)-OH 2H2O;L-(3,5-DIBROMO, 4-HYDROXY)PHENYLALANINE DIHYDRATE;L-(3,5-DIBROMO)TYROSINE DIHYDRATE;L-Tyr(3',5'-Br2);5,5'-Dibromo-2,2'-dihydroxybenzil;Dibromotyrosine | | CAS: | 300-38-9 | | MF: | C9H9Br2NO3 | | MW: | 338.98 | | EINECS: | 206-091-5 | | Product Categories: | Pharmaceutical Raw Materials | | Mol File: | 300-38-9.mol |  |
| | 3,5-Dibromo-L-tyrosine Chemical Properties |
| Melting point | 245°C | | Boiling point | 416.6±45.0 °C(Predicted) | | density | 1.9706 (rough estimate) | | refractive index | 0.8 ° (C=5, 1mol/L HCl) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Aqueous Base (Slightly), Methanol (Slightly, Sonicated), Water (Slightly) | | form | Solid | | pka | 2.17, 6.45, 7.60(at 25℃) | | color | White to Off-White | | Optical Rotation | 0.7°(C=0.01g/ml IN HCL) | | Merck | 14,3030 | | InChI | InChI=1S/C9H9Br2NO3/c10-5-1-4(2-6(11)8(5)13)3-7(12)9(14)15/h1-2,7,13H,3,12H2,(H,14,15)/t7-/m0/s1 | | InChIKey | COESHZUDRKCEPA-UHFFFAOYSA-N | | SMILES | C(O)(=O)[C@H](CC1=CC(Br)=C(O)C(Br)=C1)N | | CAS DataBase Reference | 300-38-9(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2922.50.4000 | | HazardClass | IRRITANT |
| | 3,5-Dibromo-L-tyrosine Usage And Synthesis |
| Chemical Properties | Crystalline | | Uses | 3,5-Dibromo-L-tyrosine is a dibrominated derivative of L-Tyrosine (T899975), one of the 22 proteinogenic amino acids that are used by cells to synthesize proteins. | | Definition | ChEBI: A bromoamino acid that is L-tyrosine carrying bromo- substituents at positions C-3 and C-5 of the benzyl group. |
| | 3,5-Dibromo-L-tyrosine Preparation Products And Raw materials |
|