| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Carbonic acid tert-butyl phthalimido ester Basic information |
| | Carbonic acid tert-butyl phthalimido ester Chemical Properties |
| Melting point | 118 °C (dec.)(lit.) | | Boiling point | 363.2±25.0 °C(Predicted) | | density | 1.34±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | color | White to Almost white | | InChI | 1S/C13H13NO5/c1-13(2,3)18-12(17)19-14-10(15)8-6-4-5-7-9(8)11(14)16/h4-7H,1-3H3 | | InChIKey | MCWXBNWFVFOQAS-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)ON1C(=O)c2ccccc2C1=O | | CAS DataBase Reference | 15263-20-4(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 2925.19.4200 | | Storage Class | 11 - Combustible Solids |
| | Carbonic acid tert-butyl phthalimido ester Usage And Synthesis |
| Chemical Properties | White to almost white crystalline powder | | Uses | N-(tert-Butoxycarbonyloxy)phthalimide may be used in chemical synthesis studies. | | General Description | t-Boc reagent. |
| | Carbonic acid tert-butyl phthalimido ester Preparation Products And Raw materials |
|