|
|
| | 5-CHLORO-1,10-PHENANTHROLINE Basic information |
| | 5-CHLORO-1,10-PHENANTHROLINE Chemical Properties |
| Melting point | 124-126 °C (lit.) | | Boiling point | 397.4±22.0 °C(Predicted) | | density | 1.375±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | It is soluble in organic solvents. | | form | Crystalline | | pka | 4.02±0.10(Predicted) | | color | White to Light yellow to Light orange | | Sensitive | Hygroscopic | | InChI | InChI=1S/C12H7ClN2/c13-10-7-8-3-1-5-14-11(8)12-9(10)4-2-6-15-12/h1-7H | | InChIKey | XDUUQOQFSWSZSM-UHFFFAOYSA-N | | SMILES | N1C2C(=C(Cl)C=C3C=2N=CC=C3)C=CC=1 | | CAS DataBase Reference | 4199-89-7(CAS DataBase Reference) | | EPA Substance Registry System | 1,10-Phenanthroline, 5-chloro- (4199-89-7) |
| Hazard Codes | Xn | | Risk Statements | 22-41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2933.49.7000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | 5-CHLORO-1,10-PHENANTHROLINE Usage And Synthesis |
| Uses | Used to prepare 1,10-phenanthrolinium cation. It is also used to make other chemicals. | | Uses | 5-Chloro-1,10-phenanthroline was used in preparation of:
- 1,10-phenanthrolinium cation, new building block for the design of ionic liquid crystals
- platinum(II)-based metallointercalators
|
| | 5-CHLORO-1,10-PHENANTHROLINE Preparation Products And Raw materials |
|